C18H20N4O3 — CID 109004822
2-(1,3-benzodioxol-5-ylamino)-1-(4-pyridin-2-ylpiperazin-1-yl)ethanone (PubChem CID 109004822) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-1-(4-pyridin-2-ylpiperazin-1-yl)ethanone.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-1-(4-pyridin-2-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 109004822 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-1-(4-pyridin-2-ylpiperazin-1-yl)ethanone |
| SMILES | O=C(CNc1ccc2c(c1)OCO2)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C18H20N4O3/c23-18(12-20-14-4-5-15-16(11-14)25-13-24-15)22-9-7-21(8-10-22)17-3-1-2-6-19-17/h1-6,11,20H,7-10,12-13H2 |
| InChIKey | PEACJZQCSPXEPI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|