C23H31N3O3 — CID 109005273
2-[2-(4-methoxyphenoxy)ethylamino]-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide (PubChem CID 109005273) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenoxy)ethylamino]-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide.
| Compound Name | 2-[2-(4-methoxyphenoxy)ethylamino]-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 109005273 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 2-[2-(4-methoxyphenoxy)ethylamino]-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide |
| SMILES | COc1ccc(OCCNCC(=O)Nc2ccc(N3CCC(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C23H31N3O3/c1-18-11-14-26(15-12-18)20-5-3-19(4-6-20)25-23(27)17-24-13-16-29-22-9-7-21(28-2)8-10-22/h3-10,18,24H,11-17H2,1-2H3,(H,25,27) |
| InChIKey | LTLOGEFJLAIYSE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|