C18H20F2N2O — CID 109008349
N-(4-tert-butylphenyl)-2-(2,4-difluoroanilino)acetamide (PubChem CID 109008349) has the molecular formula C18H20F2N2O and a molecular weight of 318.37 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-(2,4-difluoroanilino)acetamide.
| Compound Name | N-(4-tert-butylphenyl)-2-(2,4-difluoroanilino)acetamide |
|---|---|
| PubChem CID | 109008349 |
| Molecular Formula | C18H20F2N2O |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-(2,4-difluoroanilino)acetamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)CNc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H20F2N2O/c1-18(2,3)12-4-7-14(8-5-12)22-17(23)11-21-16-9-6-13(19)10-15(16)20/h4-10,21H,11H2,1-3H3,(H,22,23) |
| InChIKey | UQADSKVNZNOQPR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |