C18H20ClN3O — CID 109008455
N-(3-chlorophenyl)-2-(4-pyrrolidin-1-ylanilino)acetamide (PubChem CID 109008455) has the molecular formula C18H20ClN3O and a molecular weight of 329.83 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(4-pyrrolidin-1-ylanilino)acetamide.
| Compound Name | N-(3-chlorophenyl)-2-(4-pyrrolidin-1-ylanilino)acetamide |
|---|---|
| PubChem CID | 109008455 |
| Molecular Formula | C18H20ClN3O |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-(3-chlorophenyl)-2-(4-pyrrolidin-1-ylanilino)acetamide |
| SMILES | O=C(CNc1ccc(N2CCCC2)cc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H20ClN3O/c19-14-4-3-5-16(12-14)21-18(23)13-20-15-6-8-17(9-7-15)22-10-1-2-11-22/h3-9,12,20H,1-2,10-11,13H2,(H,21,23) |
| InChIKey | VQNFSJGTRKSXPY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|