C17H16ClN3O — CID 109008815
N-(2-chloro-4,6-dimethylphenyl)-2-(3-cyanoanilino)acetamide (PubChem CID 109008815) has the molecular formula C17H16ClN3O and a molecular weight of 313.79 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-2-(3-cyanoanilino)acetamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-2-(3-cyanoanilino)acetamide |
|---|---|
| PubChem CID | 109008815 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-2-(3-cyanoanilino)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CNc2cccc(C#N)c2)c(Cl)c1 |
| InChI | InChI=1S/C17H16ClN3O/c1-11-6-12(2)17(15(18)7-11)21-16(22)10-20-14-5-3-4-13(8-14)9-19/h3-8,20H,10H2,1-2H3,(H,21,22) |
| InChIKey | FWGHAGDNRPMCEX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |