About (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal
(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal (PubChem CID 10900883) has the molecular formula C13H28O2Si
and a molecular weight of 244.45 g/mol. Its IUPAC name is (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal.
Molecular Properties
| Compound Name | (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal |
| PubChem CID | 10900883 |
| Molecular Formula | C13H28O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal |
| SMILES | CC(C)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C=O |
| InChI | InChI=1S/C13H28O2Si/c1-10(2)12(11(3)9-14)15-16(7,8)13(4,5)6/h9-12H,1-8H3/t11?,12-/m1/s1 |
| InChIKey | GHSOIJFWMWSHDH-PIJUOVFKSA-N |
| XLogP | 3.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal?
The IUPAC name of (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal (CID 10900883) is (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal.
What is the SMILES notation for (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal?
The canonical SMILES for (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal is CC(C)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C=O.
What is the InChIKey of (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal?
The InChIKey is GHSOIJFWMWSHDH-PIJUOVFKSA-N. The full InChI is InChI=1S/C13H28O2Si/c1-10(2)12(11(3)9-14)15-16(7,8)13(4,5)6/h9-12H,1-8H3/t11?,12-/m1/s1.
What are the key properties of (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal?
(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal has a molecular weight of 244.45 g/mol, XLogP of 3.87, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal is sourced from PubChem (CID 10900883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).