C13H28O2Si — CID 10900883
(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal (PubChem CID 10900883) has the molecular formula C13H28O2Si and a molecular weight of 244.45 g/mol. Its IUPAC name is (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal.
| Compound Name | (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal |
|---|---|
| PubChem CID | 10900883 |
| Molecular Formula | C13H28O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanal |
| SMILES | CC(C)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C=O |
| InChI | InChI=1S/C13H28O2Si/c1-10(2)12(11(3)9-14)15-16(7,8)13(4,5)6/h9-12H,1-8H3/t11?,12-/m1/s1 |
| InChIKey | GHSOIJFWMWSHDH-PIJUOVFKSA-N |
| XLogP | 3.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|