C16H17BrN2O3 — CID 109009599
N-(2-bromophenyl)-2-(3,4-dimethoxyanilino)acetamide (PubChem CID 109009599) has the molecular formula C16H17BrN2O3 and a molecular weight of 365.23 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-(3,4-dimethoxyanilino)acetamide.
| Compound Name | N-(2-bromophenyl)-2-(3,4-dimethoxyanilino)acetamide |
|---|---|
| PubChem CID | 109009599 |
| Molecular Formula | C16H17BrN2O3 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | N-(2-bromophenyl)-2-(3,4-dimethoxyanilino)acetamide |
| SMILES | COc1ccc(NCC(=O)Nc2ccccc2Br)cc1OC |
| InChI | InChI=1S/C16H17BrN2O3/c1-21-14-8-7-11(9-15(14)22-2)18-10-16(20)19-13-6-4-3-5-12(13)17/h3-9,18H,10H2,1-2H3,(H,19,20) |
| InChIKey | HIHZGLNJGYAEBN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|