C15H20O3 — CID 10900999
(3aR,6aS,10aS)-10a-hydroxy-3a-methoxy-6,6a,7,8,9,10-hexahydro-3H-benzo[e]azulen-2-one (PubChem CID 10900999) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (3aR,6aS,10aS)-10a-hydroxy-3a-methoxy-6,6a,7,8,9,10-hexahydro-3H-benzo[e]azulen-2-one.
| Compound Name | (3aR,6aS,10aS)-10a-hydroxy-3a-methoxy-6,6a,7,8,9,10-hexahydro-3H-benzo[e]azulen-2-one |
|---|---|
| PubChem CID | 10900999 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3aR,6aS,10aS)-10a-hydroxy-3a-methoxy-6,6a,7,8,9,10-hexahydro-3H-benzo[e]azulen-2-one |
| SMILES | CO[C@]12C=CC[C@@H]3CCCC[C@@]3(O)C1=CC(=O)C2 |
| InChI | InChI=1S/C15H20O3/c1-18-14-7-4-6-11-5-2-3-8-15(11,17)13(14)9-12(16)10-14/h4,7,9,11,17H,2-3,5-6,8,10H2,1H3/t11-,14-,15-/m0/s1 |
| InChIKey | JRBXVQCSSUWDBS-CQDKDKBSSA-N |
| XLogP | 2.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|