C18H18ClF3N2O — CID 109011119
2-[4-chloro-2-(trifluoromethyl)anilino]-N-ethyl-N-(3-methylphenyl)acetamide (PubChem CID 109011119) has the molecular formula C18H18ClF3N2O and a molecular weight of 370.80 g/mol. Its IUPAC name is 2-[4-chloro-2-(trifluoromethyl)anilino]-N-ethyl-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[4-chloro-2-(trifluoromethyl)anilino]-N-ethyl-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 109011119 |
| Molecular Formula | C18H18ClF3N2O |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[4-chloro-2-(trifluoromethyl)anilino]-N-ethyl-N-(3-methylphenyl)acetamide |
| SMILES | CCN(C(=O)CNc1ccc(Cl)cc1C(F)(F)F)c1cccc(C)c1 |
| InChI | InChI=1S/C18H18ClF3N2O/c1-3-24(14-6-4-5-12(2)9-14)17(25)11-23-16-8-7-13(19)10-15(16)18(20,21)22/h4-10,23H,3,11H2,1-2H3 |
| InChIKey | SLGNLQODCODMJQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |