C14H10Cl2F2N2O — CID 109011204
N-(3,5-dichlorophenyl)-2-(2,6-difluoroanilino)acetamide (PubChem CID 109011204) has the molecular formula C14H10Cl2F2N2O and a molecular weight of 331.15 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-(2,6-difluoroanilino)acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-(2,6-difluoroanilino)acetamide |
|---|---|
| PubChem CID | 109011204 |
| Molecular Formula | C14H10Cl2F2N2O |
| Molecular Weight | 331.15 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-(2,6-difluoroanilino)acetamide |
| SMILES | O=C(CNc1c(F)cccc1F)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2F2N2O/c15-8-4-9(16)6-10(5-8)20-13(21)7-19-14-11(17)2-1-3-12(14)18/h1-6,19H,7H2,(H,20,21) |
| InChIKey | DAQVAALULFHOFR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.15 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |