About 2,6-dimethyl-4-phenyl-6H-1,3,5-oxaselenazine
2,6-dimethyl-4-phenyl-6H-1,3,5-oxaselenazine (PubChem CID 10901178) has the molecular formula C11H13NOSe
and a molecular weight of 254.19 g/mol. Its IUPAC name is 2,6-dimethyl-4-phenyl-6H-1,3,5-oxaselenazine.
Molecular Properties
| Compound Name | 2,6-dimethyl-4-phenyl-6H-1,3,5-oxaselenazine |
| PubChem CID | 10901178 |
| Molecular Formula | C11H13NOSe |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 2,6-dimethyl-4-phenyl-6H-1,3,5-oxaselenazine |
| SMILES | CC1N=C(c2ccccc2)[Se]C(C)O1 |
| InChI | InChI=1S/C11H13NOSe/c1-8-12-11(14-9(2)13-8)10-6-4-3-5-7-10/h3-9H,1-2H3 |
| InChIKey | SHNGBEAFXNEIDP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-4-phenyl-6H-1,3,5-oxaselenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4-phenyl-6H-1,3,5-oxaselenazine?
The IUPAC name of 2,6-dimethyl-4-phenyl-6H-1,3,5-oxaselenazine (CID 10901178) is 2,6-dimethyl-4-phenyl-6H-1,3,5-oxaselenazine.
What is the SMILES notation for 2,6-dimethyl-4-phenyl-6H-1,3,5-oxaselenazine?
The canonical SMILES for 2,6-dimethyl-4-phenyl-6H-1,3,5-oxaselenazine is CC1N=C(c2ccccc2)[Se]C(C)O1.
What is the InChIKey of 2,6-dimethyl-4-phenyl-6H-1,3,5-oxaselenazine?
The InChIKey is SHNGBEAFXNEIDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NOSe/c1-8-12-11(14-9(2)13-8)10-6-4-3-5-7-10/h3-9H,1-2H3.
What are the key properties of 2,6-dimethyl-4-phenyl-6H-1,3,5-oxaselenazine?
2,6-dimethyl-4-phenyl-6H-1,3,5-oxaselenazine has a molecular weight of 254.19 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4-phenyl-6H-1,3,5-oxaselenazine is sourced from PubChem (CID 10901178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).