C16H25N3O — CID 109013454
N-cyclopentyl-3-[methyl(2-pyridin-4-ylethyl)amino]propanamide (PubChem CID 109013454) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is N-cyclopentyl-3-[methyl(2-pyridin-4-ylethyl)amino]propanamide.
| Compound Name | N-cyclopentyl-3-[methyl(2-pyridin-4-ylethyl)amino]propanamide |
|---|---|
| PubChem CID | 109013454 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | N-cyclopentyl-3-[methyl(2-pyridin-4-ylethyl)amino]propanamide |
| SMILES | CN(CCC(=O)NC1CCCC1)CCc1ccncc1 |
| InChI | InChI=1S/C16H25N3O/c1-19(12-8-14-6-10-17-11-7-14)13-9-16(20)18-15-4-2-3-5-15/h6-7,10-11,15H,2-5,8-9,12-13H2,1H3,(H,18,20) |
| InChIKey | PBTIVMBFSCEYIS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |