About 6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one
6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one (PubChem CID 10901426) has the molecular formula C14H14O3S
and a molecular weight of 262.33 g/mol. Its IUPAC name is 6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one.
Molecular Properties
| Compound Name | 6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one |
| PubChem CID | 10901426 |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one |
| SMILES | O=C1C=CC2(OCCO2)C(Sc2ccccc2)C1 |
| InChI | InChI=1S/C14H14O3S/c15-11-6-7-14(16-8-9-17-14)13(10-11)18-12-4-2-1-3-5-12/h1-7,13H,8-10H2 |
| InChIKey | UCZZXVCKCKYUEN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one?
The IUPAC name of 6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one (CID 10901426) is 6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one.
What is the SMILES notation for 6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one?
The canonical SMILES for 6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one is O=C1C=CC2(OCCO2)C(Sc2ccccc2)C1.
What is the InChIKey of 6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one?
The InChIKey is UCZZXVCKCKYUEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O3S/c15-11-6-7-14(16-8-9-17-14)13(10-11)18-12-4-2-1-3-5-12/h1-7,13H,8-10H2.
What are the key properties of 6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one?
6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one has a molecular weight of 262.33 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one is sourced from PubChem (CID 10901426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).