C24H30N2O2 — CID 109014767
N-[2-(cyclohexen-1-yl)ethyl]-3-(4-phenylmethoxyanilino)propanamide (PubChem CID 109014767) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-(4-phenylmethoxyanilino)propanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-(4-phenylmethoxyanilino)propanamide |
|---|---|
| PubChem CID | 109014767 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-(4-phenylmethoxyanilino)propanamide |
| SMILES | O=C(CCNc1ccc(OCc2ccccc2)cc1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C24H30N2O2/c27-24(26-17-15-20-7-3-1-4-8-20)16-18-25-22-11-13-23(14-12-22)28-19-21-9-5-2-6-10-21/h2,5-7,9-14,25H,1,3-4,8,15-19H2,(H,26,27) |
| InChIKey | LOWKGYWOGRIMCX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|