C18H29N3O3 — CID 109015536
1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(3-methoxypropylamino)propan-1-one (PubChem CID 109015536) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(3-methoxypropylamino)propan-1-one.
| Compound Name | 1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(3-methoxypropylamino)propan-1-one |
|---|---|
| PubChem CID | 109015536 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(3-methoxypropylamino)propan-1-one |
| SMILES | COCCCNCCC(=O)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C18H29N3O3/c1-23-15-5-9-19-10-8-18(22)21-13-11-20(12-14-21)16-6-3-4-7-17(16)24-2/h3-4,6-7,19H,5,8-15H2,1-2H3 |
| InChIKey | ZJGDFRZREVJJHJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|