C13H17FO3Si — CID 10901619
(4aS,5S,8aS)-6-fluoro-5-trimethylsilyloxy-4a,5,8,8a-tetrahydronaphthalene-1,4-dione (PubChem CID 10901619) has the molecular formula C13H17FO3Si and a molecular weight of 268.36 g/mol. Its IUPAC name is (4aS,5S,8aS)-6-fluoro-5-trimethylsilyloxy-4a,5,8,8a-tetrahydronaphthalene-1,4-dione.
| Compound Name | (4aS,5S,8aS)-6-fluoro-5-trimethylsilyloxy-4a,5,8,8a-tetrahydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 10901619 |
| Molecular Formula | C13H17FO3Si |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (4aS,5S,8aS)-6-fluoro-5-trimethylsilyloxy-4a,5,8,8a-tetrahydronaphthalene-1,4-dione |
| SMILES | C[Si](C)(C)O[C@@H]1C(F)=CC[C@@H]2C(=O)C=CC(=O)[C@@H]21 |
| InChI | InChI=1S/C13H17FO3Si/c1-18(2,3)17-13-9(14)5-4-8-10(15)6-7-11(16)12(8)13/h5-8,12-13H,4H2,1-3H3/t8-,12-,13-/m1/s1 |
| InChIKey | VBSGQPANKGIEBV-BZHVJNSISA-N |
| XLogP | 2.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|