C20H33N5O2 — CID 109016826
N-[4-(4-methylpiperazin-1-yl)phenyl]-3-(2-morpholin-4-ylethylamino)propanamide (PubChem CID 109016826) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-3-(2-morpholin-4-ylethylamino)propanamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-3-(2-morpholin-4-ylethylamino)propanamide |
|---|---|
| PubChem CID | 109016826 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-3-(2-morpholin-4-ylethylamino)propanamide |
| SMILES | CN1CCN(c2ccc(NC(=O)CCNCCN3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C20H33N5O2/c1-23-10-12-25(13-11-23)19-4-2-18(3-5-19)22-20(26)6-7-21-8-9-24-14-16-27-17-15-24/h2-5,21H,6-17H2,1H3,(H,22,26) |
| InChIKey | MBLMQMKOPJWPRT-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|