C15H21Cl2N3O — CID 109017604
3-(3,4-dichloroanilino)-1-(4-ethylpiperazin-1-yl)propan-1-one (PubChem CID 109017604) has the molecular formula C15H21Cl2N3O and a molecular weight of 330.26 g/mol. Its IUPAC name is 3-(3,4-dichloroanilino)-1-(4-ethylpiperazin-1-yl)propan-1-one.
| Compound Name | 3-(3,4-dichloroanilino)-1-(4-ethylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 109017604 |
| Molecular Formula | C15H21Cl2N3O |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 3-(3,4-dichloroanilino)-1-(4-ethylpiperazin-1-yl)propan-1-one |
| SMILES | CCN1CCN(C(=O)CCNc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H21Cl2N3O/c1-2-19-7-9-20(10-8-19)15(21)5-6-18-12-3-4-13(16)14(17)11-12/h3-4,11,18H,2,5-10H2,1H3 |
| InChIKey | IRDGTPSJKCVDNE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |