C14H21Cl2N — CID 10901783
(2'S,3'R,5S,7R)-2',3'-dichloro-3,5,7-trimethylspiro[1-azatricyclo[3.3.1.13,7]decane-2,1'-cyclopropane] (PubChem CID 10901783) has the molecular formula C14H21Cl2N and a molecular weight of 274.23 g/mol. Its IUPAC name is (2'S,3'R,5S,7R)-2',3'-dichloro-3,5,7-trimethylspiro[1-azatricyclo[3.3.1.13,7]decane-2,1'-cyclopropane].
| Compound Name | (2'S,3'R,5S,7R)-2',3'-dichloro-3,5,7-trimethylspiro[1-azatricyclo[3.3.1.13,7]decane-2,1'-cyclopropane] |
|---|---|
| PubChem CID | 10901783 |
| Molecular Formula | C14H21Cl2N |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | (2'S,3'R,5S,7R)-2',3'-dichloro-3,5,7-trimethylspiro[1-azatricyclo[3.3.1.13,7]decane-2,1'-cyclopropane] |
| SMILES | CC12C[C@]3(C)CN(C[C@](C)(C1)C3)C21[C@H](Cl)[C@@H]1Cl |
| InChI | InChI=1S/C14H21Cl2N/c1-11-4-12(2)6-13(3,5-11)14(9(15)10(14)16)17(7-11)8-12/h9-10H,4-8H2,1-3H3/t9-,10+,11-,12+,13?,14? |
| InChIKey | UVAUHMLOPHVDDW-QHMRNEKISA-N |
| XLogP | 3.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|