About CID 10901807
CID 10901807 (PubChem CID 10901807) has the molecular formula C8H6ClO
and a molecular weight of 153.59 g/mol.
Molecular Properties
| Compound Name | CID 10901807 |
| PubChem CID | 10901807 |
| Molecular Formula | C8H6ClO |
| Molecular Weight | 153.59 g/mol |
| Exact Mass | 153.01 |
| IUPAC Name | — |
| SMILES | O=C/C=C(/Cl)[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C8H6ClO/c9-8(5-6-10)7-3-1-2-4-7/h1-6H/b8-5+ |
| InChIKey | KBGMTIOSDMWGGQ-VMPITWQZSA-N |
| XLogP | 1.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.59 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 10901807 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10901807?
The IUPAC name of CID 10901807 (CID 10901807) is not available.
What is the SMILES notation for CID 10901807?
The canonical SMILES for CID 10901807 is O=C/C=C(/Cl)[C]1[CH][CH][CH][CH]1.
What is the InChIKey of CID 10901807?
The InChIKey is KBGMTIOSDMWGGQ-VMPITWQZSA-N. The full InChI is InChI=1S/C8H6ClO/c9-8(5-6-10)7-3-1-2-4-7/h1-6H/b8-5+.
What are the key properties of CID 10901807?
CID 10901807 has a molecular weight of 153.59 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10901807 is sourced from PubChem (CID 10901807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).