C12H20O7 — CID 10901845
(4R,5S,6S)-4,5,6-tris(methoxymethoxy)cyclohex-2-en-1-one (PubChem CID 10901845) has the molecular formula C12H20O7 and a molecular weight of 276.29 g/mol. Its IUPAC name is (4R,5S,6S)-4,5,6-tris(methoxymethoxy)cyclohex-2-en-1-one.
| Compound Name | (4R,5S,6S)-4,5,6-tris(methoxymethoxy)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 10901845 |
| Molecular Formula | C12H20O7 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (4R,5S,6S)-4,5,6-tris(methoxymethoxy)cyclohex-2-en-1-one |
| SMILES | COCO[C@@H]1[C@H](OCOC)C(=O)C=C[C@H]1OCOC |
| InChI | InChI=1S/C12H20O7/c1-14-6-17-10-5-4-9(13)11(18-7-15-2)12(10)19-8-16-3/h4-5,10-12H,6-8H2,1-3H3/t10-,11-,12+/m1/s1 |
| InChIKey | JVABUFVWVLDTGT-UTUOFQBUSA-N |
| XLogP | 0.09 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|