C16H16Cl2N2O — CID 109018893
N-benzyl-3-(3,5-dichloroanilino)propanamide (PubChem CID 109018893) has the molecular formula C16H16Cl2N2O and a molecular weight of 323.22 g/mol. Its IUPAC name is N-benzyl-3-(3,5-dichloroanilino)propanamide.
| Compound Name | N-benzyl-3-(3,5-dichloroanilino)propanamide |
|---|---|
| PubChem CID | 109018893 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | N-benzyl-3-(3,5-dichloroanilino)propanamide |
| SMILES | O=C(CCNc1cc(Cl)cc(Cl)c1)NCc1ccccc1 |
| InChI | InChI=1S/C16H16Cl2N2O/c17-13-8-14(18)10-15(9-13)19-7-6-16(21)20-11-12-4-2-1-3-5-12/h1-5,8-10,19H,6-7,11H2,(H,20,21) |
| InChIKey | NPOFHTXEGQYLKZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |