C17H18Cl2N2O — CID 109019724
N-(3,4-dichlorophenyl)-3-[(3-methylphenyl)methylamino]propanamide (PubChem CID 109019724) has the molecular formula C17H18Cl2N2O and a molecular weight of 337.25 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-[(3-methylphenyl)methylamino]propanamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-[(3-methylphenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 109019724 |
| Molecular Formula | C17H18Cl2N2O |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-[(3-methylphenyl)methylamino]propanamide |
| SMILES | Cc1cccc(CNCCC(=O)Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C17H18Cl2N2O/c1-12-3-2-4-13(9-12)11-20-8-7-17(22)21-14-5-6-15(18)16(19)10-14/h2-6,9-10,20H,7-8,11H2,1H3,(H,21,22) |
| InChIKey | JUDTVAVPFFAAAB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|