C21H28N2O — CID 109019825
3-(4-tert-butylanilino)-N-[(4-methylphenyl)methyl]propanamide (PubChem CID 109019825) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is 3-(4-tert-butylanilino)-N-[(4-methylphenyl)methyl]propanamide.
| Compound Name | 3-(4-tert-butylanilino)-N-[(4-methylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 109019825 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 3-(4-tert-butylanilino)-N-[(4-methylphenyl)methyl]propanamide |
| SMILES | Cc1ccc(CNC(=O)CCNc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H28N2O/c1-16-5-7-17(8-6-16)15-23-20(24)13-14-22-19-11-9-18(10-12-19)21(2,3)4/h5-12,22H,13-15H2,1-4H3,(H,23,24) |
| InChIKey | FUEWLRRQAOZDAT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |