C14H16O4S — CID 10901996
(5Z)-8-(benzenesulfonyl)-3,4,7,8-tetrahydro-2H-oxonin-9-one (PubChem CID 10901996) has the molecular formula C14H16O4S and a molecular weight of 280.34 g/mol. Its IUPAC name is (5Z)-8-(benzenesulfonyl)-3,4,7,8-tetrahydro-2H-oxonin-9-one.
| Compound Name | (5Z)-8-(benzenesulfonyl)-3,4,7,8-tetrahydro-2H-oxonin-9-one |
|---|---|
| PubChem CID | 10901996 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (5Z)-8-(benzenesulfonyl)-3,4,7,8-tetrahydro-2H-oxonin-9-one |
| SMILES | O=C1OCCC/C=C\CC1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H16O4S/c15-14-13(10-6-1-2-7-11-18-14)19(16,17)12-8-4-3-5-9-12/h1,3-6,8-9,13H,2,7,10-11H2/b6-1- |
| InChIKey | XHZAOIOGJYQBRC-BHQIHCQQSA-N |
| XLogP | 2.11 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|