C17H21N3O — CID 109020395
N-benzyl-N-methyl-3-(pyridin-3-ylmethylamino)propanamide (PubChem CID 109020395) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is N-benzyl-N-methyl-3-(pyridin-3-ylmethylamino)propanamide.
| Compound Name | N-benzyl-N-methyl-3-(pyridin-3-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 109020395 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N-benzyl-N-methyl-3-(pyridin-3-ylmethylamino)propanamide |
| SMILES | CN(Cc1ccccc1)C(=O)CCNCc1cccnc1 |
| InChI | InChI=1S/C17H21N3O/c1-20(14-15-6-3-2-4-7-15)17(21)9-11-19-13-16-8-5-10-18-12-16/h2-8,10,12,19H,9,11,13-14H2,1H3 |
| InChIKey | QJBIKMKOXUBPSO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|