About 5-(2,4-dichlorophenyl)-6-ethylpyrimidine-2,4-diamine
5-(2,4-dichlorophenyl)-6-ethylpyrimidine-2,4-diamine (PubChem CID 10902094) has the molecular formula C12H12Cl2N4
and a molecular weight of 283.16 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-6-ethylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-(2,4-dichlorophenyl)-6-ethylpyrimidine-2,4-diamine |
| PubChem CID | 10902094 |
| Molecular Formula | C12H12Cl2N4 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-6-ethylpyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2N4/c1-2-9-10(11(15)18-12(16)17-9)7-4-3-6(13)5-8(7)14/h3-5H,2H2,1H3,(H4,15,16,17,18) |
| InChIKey | FALVLEJFCVFMDS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,4-dichlorophenyl)-6-ethylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dichlorophenyl)-6-ethylpyrimidine-2,4-diamine?
The IUPAC name of 5-(2,4-dichlorophenyl)-6-ethylpyrimidine-2,4-diamine (CID 10902094) is 5-(2,4-dichlorophenyl)-6-ethylpyrimidine-2,4-diamine.
What is the SMILES notation for 5-(2,4-dichlorophenyl)-6-ethylpyrimidine-2,4-diamine?
The canonical SMILES for 5-(2,4-dichlorophenyl)-6-ethylpyrimidine-2,4-diamine is CCc1nc(N)nc(N)c1-c1ccc(Cl)cc1Cl.
What is the InChIKey of 5-(2,4-dichlorophenyl)-6-ethylpyrimidine-2,4-diamine?
The InChIKey is FALVLEJFCVFMDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2N4/c1-2-9-10(11(15)18-12(16)17-9)7-4-3-6(13)5-8(7)14/h3-5H,2H2,1H3,(H4,15,16,17,18).
What are the key properties of 5-(2,4-dichlorophenyl)-6-ethylpyrimidine-2,4-diamine?
5-(2,4-dichlorophenyl)-6-ethylpyrimidine-2,4-diamine has a molecular weight of 283.16 g/mol, XLogP of 3.18, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dichlorophenyl)-6-ethylpyrimidine-2,4-diamine is sourced from PubChem (CID 10902094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).