C15H28O3Si — CID 10902154
(E,5R)-5-cyclohexyl-1-methoxy-5-trimethylsilyloxypent-1-en-3-one (PubChem CID 10902154) has the molecular formula C15H28O3Si and a molecular weight of 284.47 g/mol. Its IUPAC name is (E,5R)-5-cyclohexyl-1-methoxy-5-trimethylsilyloxypent-1-en-3-one.
| Compound Name | (E,5R)-5-cyclohexyl-1-methoxy-5-trimethylsilyloxypent-1-en-3-one |
|---|---|
| PubChem CID | 10902154 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (E,5R)-5-cyclohexyl-1-methoxy-5-trimethylsilyloxypent-1-en-3-one |
| SMILES | CO/C=C/C(=O)C[C@@H](O[Si](C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C15H28O3Si/c1-17-11-10-14(16)12-15(18-19(2,3)4)13-8-6-5-7-9-13/h10-11,13,15H,5-9,12H2,1-4H3/b11-10+/t15-/m1/s1 |
| InChIKey | MIJGDDJDURHVOC-AUECHBEKSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|