C17H17ClN2 — CID 10902160
(3S,10aR)-3-(4-chlorophenyl)-1,2,3,5,10,10a-hexahydroimidazo[1,5-b]isoquinoline (PubChem CID 10902160) has the molecular formula C17H17ClN2 and a molecular weight of 284.79 g/mol. Its IUPAC name is (3S,10aR)-3-(4-chlorophenyl)-1,2,3,5,10,10a-hexahydroimidazo[1,5-b]isoquinoline.
| Compound Name | (3S,10aR)-3-(4-chlorophenyl)-1,2,3,5,10,10a-hexahydroimidazo[1,5-b]isoquinoline |
|---|---|
| PubChem CID | 10902160 |
| Molecular Formula | C17H17ClN2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (3S,10aR)-3-(4-chlorophenyl)-1,2,3,5,10,10a-hexahydroimidazo[1,5-b]isoquinoline |
| SMILES | Clc1ccc([C@H]2NC[C@H]3Cc4ccccc4CN32)cc1 |
| InChI | InChI=1S/C17H17ClN2/c18-15-7-5-12(6-8-15)17-19-10-16-9-13-3-1-2-4-14(13)11-20(16)17/h1-8,16-17,19H,9-11H2/t16-,17+/m1/s1 |
| InChIKey | HDXYJMRYBOIYFI-SJORKVTESA-N |
| XLogP | 3.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |