C19H22N2O4 — CID 109022230
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(2-methoxyphenyl)methylamino]propanamide (PubChem CID 109022230) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(2-methoxyphenyl)methylamino]propanamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(2-methoxyphenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 109022230 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(2-methoxyphenyl)methylamino]propanamide |
| SMILES | COc1ccccc1CNCCC(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H22N2O4/c1-23-16-5-3-2-4-14(16)13-20-9-8-19(22)21-15-6-7-17-18(12-15)25-11-10-24-17/h2-7,12,20H,8-11,13H2,1H3,(H,21,22) |
| InChIKey | VUKPFIUFIOZZCZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|