C18H21BrN2O2 — CID 109022539
N-(2-bromo-4-methylphenyl)-3-[(4-methoxyphenyl)methylamino]propanamide (PubChem CID 109022539) has the molecular formula C18H21BrN2O2 and a molecular weight of 377.28 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-3-[(4-methoxyphenyl)methylamino]propanamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-3-[(4-methoxyphenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 109022539 |
| Molecular Formula | C18H21BrN2O2 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-3-[(4-methoxyphenyl)methylamino]propanamide |
| SMILES | COc1ccc(CNCCC(=O)Nc2ccc(C)cc2Br)cc1 |
| InChI | InChI=1S/C18H21BrN2O2/c1-13-3-8-17(16(19)11-13)21-18(22)9-10-20-12-14-4-6-15(23-2)7-5-14/h3-8,11,20H,9-10,12H2,1-2H3,(H,21,22) |
| InChIKey | ZPIARFYKAWHVQQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|