C17H21NO3 — CID 10902256
2-[(1R,3aS,4S,7aR)-6-methoxy-4-methyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyran-1-yl]-1H-indole (PubChem CID 10902256) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[(1R,3aS,4S,7aR)-6-methoxy-4-methyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyran-1-yl]-1H-indole.
| Compound Name | 2-[(1R,3aS,4S,7aR)-6-methoxy-4-methyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyran-1-yl]-1H-indole |
|---|---|
| PubChem CID | 10902256 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-[(1R,3aS,4S,7aR)-6-methoxy-4-methyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyran-1-yl]-1H-indole |
| SMILES | COC1C[C@@H]2[C@@H](CO[C@H]2c2cc3ccccc3[nH]2)[C@H](C)O1 |
| InChI | InChI=1S/C17H21NO3/c1-10-13-9-20-17(12(13)8-16(19-2)21-10)15-7-11-5-3-4-6-14(11)18-15/h3-7,10,12-13,16-18H,8-9H2,1-2H3/t10-,12+,13-,16?,17+/m0/s1 |
| InChIKey | SXGFIJHXBLDGGZ-KLNBTKIRSA-N |
| XLogP | 3.25 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |