C16H24O5 — CID 10902541
ethyl (1R,6R,6aR)-6-(ethoxymethoxy)-5,5-dimethyl-2-oxo-1,4,6,6a-tetrahydropentalene-1-carboxylate (PubChem CID 10902541) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is ethyl (1R,6R,6aR)-6-(ethoxymethoxy)-5,5-dimethyl-2-oxo-1,4,6,6a-tetrahydropentalene-1-carboxylate.
| Compound Name | ethyl (1R,6R,6aR)-6-(ethoxymethoxy)-5,5-dimethyl-2-oxo-1,4,6,6a-tetrahydropentalene-1-carboxylate |
|---|---|
| PubChem CID | 10902541 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | ethyl (1R,6R,6aR)-6-(ethoxymethoxy)-5,5-dimethyl-2-oxo-1,4,6,6a-tetrahydropentalene-1-carboxylate |
| SMILES | CCOCO[C@@H]1[C@H]2C(=CC(=O)[C@@H]2C(=O)OCC)CC1(C)C |
| InChI | InChI=1S/C16H24O5/c1-5-19-9-21-14-12-10(8-16(14,3)4)7-11(17)13(12)15(18)20-6-2/h7,12-14H,5-6,8-9H2,1-4H3/t12-,13-,14+/m0/s1 |
| InChIKey | OVVYFECHLLATAF-MELADBBJSA-N |
| XLogP | 2.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|