C21H28N2O3 — CID 109025818
N-[2-(4-methoxyphenyl)ethyl]-3-(4-propan-2-yloxyanilino)propanamide (PubChem CID 109025818) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-3-(4-propan-2-yloxyanilino)propanamide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-3-(4-propan-2-yloxyanilino)propanamide |
|---|---|
| PubChem CID | 109025818 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-3-(4-propan-2-yloxyanilino)propanamide |
| SMILES | COc1ccc(CCNC(=O)CCNc2ccc(OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H28N2O3/c1-16(2)26-20-10-6-18(7-11-20)22-15-13-21(24)23-14-12-17-4-8-19(25-3)9-5-17/h4-11,16,22H,12-15H2,1-3H3,(H,23,24) |
| InChIKey | OGVRLLYOBVLKEX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|