C14H21NO6 — CID 10902620
[(1R)-1-[(2S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxooxolan-2-yl]prop-2-enyl] acetate (PubChem CID 10902620) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is [(1R)-1-[(2S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxooxolan-2-yl]prop-2-enyl] acetate.
| Compound Name | [(1R)-1-[(2S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxooxolan-2-yl]prop-2-enyl] acetate |
|---|---|
| PubChem CID | 10902620 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [(1R)-1-[(2S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxooxolan-2-yl]prop-2-enyl] acetate |
| SMILES | C=C[C@@H](OC(C)=O)[C@H]1OC(=O)C[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21NO6/c1-6-10(19-8(2)16)12-9(7-11(17)20-12)15-13(18)21-14(3,4)5/h6,9-10,12H,1,7H2,2-5H3,(H,15,18)/t9-,10+,12-/m0/s1 |
| InChIKey | MLSKLIQSUSJTIV-UMNHJUIQSA-N |
| XLogP | 1.31 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|