C21H29N5O3 — CID 109027810
3-[2-(3,4-dimethoxyphenyl)ethylamino]-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one (PubChem CID 109027810) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethylamino]-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethylamino]-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 109027810 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethylamino]-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
| SMILES | COc1ccc(CCNCCC(=O)N2CCN(c3ncccn3)CC2)cc1OC |
| InChI | InChI=1S/C21H29N5O3/c1-28-18-5-4-17(16-19(18)29-2)6-10-22-11-7-20(27)25-12-14-26(15-13-25)21-23-8-3-9-24-21/h3-5,8-9,16,22H,6-7,10-15H2,1-2H3 |
| InChIKey | GMHXUAKZRVIJFA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|