C17H17Cl3N2O — CID 109027992
N-[2-(4-chlorophenyl)ethyl]-3-(2,3-dichloroanilino)propanamide (PubChem CID 109027992) has the molecular formula C17H17Cl3N2O and a molecular weight of 371.70 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-3-(2,3-dichloroanilino)propanamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-3-(2,3-dichloroanilino)propanamide |
|---|---|
| PubChem CID | 109027992 |
| Molecular Formula | C17H17Cl3N2O |
| Molecular Weight | 371.70 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-3-(2,3-dichloroanilino)propanamide |
| SMILES | O=C(CCNc1cccc(Cl)c1Cl)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17Cl3N2O/c18-13-6-4-12(5-7-13)8-10-22-16(23)9-11-21-15-3-1-2-14(19)17(15)20/h1-7,21H,8-11H2,(H,22,23) |
| InChIKey | QZWAFFQMTUDKFH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.70 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |