C15H21BrN2O3S — CID 109028783
N-(2-bromophenyl)-3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanamide (PubChem CID 109028783) has the molecular formula C15H21BrN2O3S and a molecular weight of 389.32 g/mol. Its IUPAC name is N-(2-bromophenyl)-3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanamide.
| Compound Name | N-(2-bromophenyl)-3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanamide |
|---|---|
| PubChem CID | 109028783 |
| Molecular Formula | C15H21BrN2O3S |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | N-(2-bromophenyl)-3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanamide |
| SMILES | CCN(CCC(=O)Nc1ccccc1Br)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H21BrN2O3S/c1-2-18(12-8-10-22(20,21)11-12)9-7-15(19)17-14-6-4-3-5-13(14)16/h3-6,12H,2,7-11H2,1H3,(H,17,19) |
| InChIKey | BRLICYVIZFVJPE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |