C21H32N4O3 — CID 109029182
ethyl 4-[3-oxo-3-(4-piperidin-1-ylanilino)propyl]piperazine-1-carboxylate (PubChem CID 109029182) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is ethyl 4-[3-oxo-3-(4-piperidin-1-ylanilino)propyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-oxo-3-(4-piperidin-1-ylanilino)propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109029182 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | ethyl 4-[3-oxo-3-(4-piperidin-1-ylanilino)propyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CCC(=O)Nc2ccc(N3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C21H32N4O3/c1-2-28-21(27)25-16-14-23(15-17-25)13-10-20(26)22-18-6-8-19(9-7-18)24-11-4-3-5-12-24/h6-9H,2-5,10-17H2,1H3,(H,22,26) |
| InChIKey | JZGPQIJFDYWZRM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|