C20H30FN3O — CID 109029809
3-(cycloheptylamino)-1-[4-(2-fluorophenyl)piperazin-1-yl]propan-1-one (PubChem CID 109029809) has the molecular formula C20H30FN3O and a molecular weight of 347.48 g/mol. Its IUPAC name is 3-(cycloheptylamino)-1-[4-(2-fluorophenyl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-(cycloheptylamino)-1-[4-(2-fluorophenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 109029809 |
| Molecular Formula | C20H30FN3O |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 3-(cycloheptylamino)-1-[4-(2-fluorophenyl)piperazin-1-yl]propan-1-one |
| SMILES | O=C(CCNC1CCCCCC1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H30FN3O/c21-18-9-5-6-10-19(18)23-13-15-24(16-14-23)20(25)11-12-22-17-7-3-1-2-4-8-17/h5-6,9-10,17,22H,1-4,7-8,11-16H2 |
| InChIKey | PRSJHPVELPSGPT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |