C17H28N4O — CID 109030233
3-(pentylamino)-1-(4-pyridin-2-ylpiperazin-1-yl)propan-1-one (PubChem CID 109030233) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is 3-(pentylamino)-1-(4-pyridin-2-ylpiperazin-1-yl)propan-1-one.
| Compound Name | 3-(pentylamino)-1-(4-pyridin-2-ylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 109030233 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 3-(pentylamino)-1-(4-pyridin-2-ylpiperazin-1-yl)propan-1-one |
| SMILES | CCCCCNCCC(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C17H28N4O/c1-2-3-5-9-18-11-8-17(22)21-14-12-20(13-15-21)16-7-4-6-10-19-16/h4,6-7,10,18H,2-3,5,8-9,11-15H2,1H3 |
| InChIKey | CNQPNDGTEQLSQW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|