C11H6F7N3 — CID 10903073
5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1H-1,2,4-triazole (PubChem CID 10903073) has the molecular formula C11H6F7N3 and a molecular weight of 313.18 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1H-1,2,4-triazole.
| Compound Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 10903073 |
| Molecular Formula | C11H6F7N3 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1H-1,2,4-triazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)c1nc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C11H6F7N3/c12-9(13,10(14,15)11(16,17)18)8-19-7(20-21-8)6-4-2-1-3-5-6/h1-5H,(H,19,20,21) |
| InChIKey | AIZAMOOEHGSUGQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|