C18H20Cl2N2O3 — CID 109031081
3-(2,4-dichloroanilino)-N-[2-(4-methoxyphenoxy)ethyl]propanamide (PubChem CID 109031081) has the molecular formula C18H20Cl2N2O3 and a molecular weight of 383.28 g/mol. Its IUPAC name is 3-(2,4-dichloroanilino)-N-[2-(4-methoxyphenoxy)ethyl]propanamide.
| Compound Name | 3-(2,4-dichloroanilino)-N-[2-(4-methoxyphenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 109031081 |
| Molecular Formula | C18H20Cl2N2O3 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 3-(2,4-dichloroanilino)-N-[2-(4-methoxyphenoxy)ethyl]propanamide |
| SMILES | COc1ccc(OCCNC(=O)CCNc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H20Cl2N2O3/c1-24-14-3-5-15(6-4-14)25-11-10-22-18(23)8-9-21-17-7-2-13(19)12-16(17)20/h2-7,12,21H,8-11H2,1H3,(H,22,23) |
| InChIKey | PMFXHIAUKZUUTL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|