C16H32O4Si — CID 10903188
[(4S,5S)-5-[(2R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 10903188) has the molecular formula C16H32O4Si and a molecular weight of 316.51 g/mol. Its IUPAC name is [(4S,5S)-5-[(2R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4S,5S)-5-[(2R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 10903188 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | [(4S,5S)-5-[(2R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | C=C[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1CO |
| InChI | InChI=1S/C16H32O4Si/c1-9-12(11-18-21(7,8)15(2,3)4)14-13(10-17)19-16(5,6)20-14/h9,12-14,17H,1,10-11H2,2-8H3/t12-,13+,14+/m1/s1 |
| InChIKey | CEFNTBRUODBBDY-RDBSUJKOSA-N |
| XLogP | 3.32 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|