About 3-[butyl(methyl)amino]-N,N-dipropylpropanamide
3-[butyl(methyl)amino]-N,N-dipropylpropanamide (PubChem CID 109032448) has the molecular formula C14H30N2O
and a molecular weight of 242.41 g/mol. Its IUPAC name is 3-[butyl(methyl)amino]-N,N-dipropylpropanamide.
Molecular Properties
| Compound Name | 3-[butyl(methyl)amino]-N,N-dipropylpropanamide |
| PubChem CID | 109032448 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 3-[butyl(methyl)amino]-N,N-dipropylpropanamide |
| SMILES | CCCCN(C)CCC(=O)N(CCC)CCC |
| InChI | InChI=1S/C14H30N2O/c1-5-8-12-15(4)13-9-14(17)16(10-6-2)11-7-3/h5-13H2,1-4H3 |
| InChIKey | ABHZOEXJPGAWAE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[butyl(methyl)amino]-N,N-dipropylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[butyl(methyl)amino]-N,N-dipropylpropanamide?
The IUPAC name of 3-[butyl(methyl)amino]-N,N-dipropylpropanamide (CID 109032448) is 3-[butyl(methyl)amino]-N,N-dipropylpropanamide.
What is the SMILES notation for 3-[butyl(methyl)amino]-N,N-dipropylpropanamide?
The canonical SMILES for 3-[butyl(methyl)amino]-N,N-dipropylpropanamide is CCCCN(C)CCC(=O)N(CCC)CCC.
What is the InChIKey of 3-[butyl(methyl)amino]-N,N-dipropylpropanamide?
The InChIKey is ABHZOEXJPGAWAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2O/c1-5-8-12-15(4)13-9-14(17)16(10-6-2)11-7-3/h5-13H2,1-4H3.
What are the key properties of 3-[butyl(methyl)amino]-N,N-dipropylpropanamide?
3-[butyl(methyl)amino]-N,N-dipropylpropanamide has a molecular weight of 242.41 g/mol, XLogP of 2.76, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[butyl(methyl)amino]-N,N-dipropylpropanamide is sourced from PubChem (CID 109032448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).