C9H13N2O2+ — CID 10903274
(1E,3E,5E)-1-ethoxy-1-hydroxyhepta-1,3,5-triene-2-diazonium (PubChem CID 10903274) has the molecular formula C9H13N2O2+ and a molecular weight of 181.22 g/mol. Its IUPAC name is (1E,3E,5E)-1-ethoxy-1-hydroxyhepta-1,3,5-triene-2-diazonium.
| Compound Name | (1E,3E,5E)-1-ethoxy-1-hydroxyhepta-1,3,5-triene-2-diazonium |
|---|---|
| PubChem CID | 10903274 |
| Molecular Formula | C9H13N2O2+ |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | (1E,3E,5E)-1-ethoxy-1-hydroxyhepta-1,3,5-triene-2-diazonium |
| SMILES | C/C=C/C=C/C([N+]#N)=C(/O)OCC |
| InChI | InChI=1S/C9H12N2O2/c1-3-5-6-7-8(11-10)9(12)13-4-2/h3,5-7H,4H2,1-2H3/p+1/b5-3+,7-6+,9-8+ |
| InChIKey | UQYNHEQTJXJPEZ-HBJGMSRDSA-O |
| XLogP | 2.74 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|