C20H25ClN2O — CID 109033314
3-[2-(3-chlorophenyl)ethylamino]-N-(2-ethyl-6-methylphenyl)propanamide (PubChem CID 109033314) has the molecular formula C20H25ClN2O and a molecular weight of 344.89 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)ethylamino]-N-(2-ethyl-6-methylphenyl)propanamide.
| Compound Name | 3-[2-(3-chlorophenyl)ethylamino]-N-(2-ethyl-6-methylphenyl)propanamide |
|---|---|
| PubChem CID | 109033314 |
| Molecular Formula | C20H25ClN2O |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-[2-(3-chlorophenyl)ethylamino]-N-(2-ethyl-6-methylphenyl)propanamide |
| SMILES | CCc1cccc(C)c1NC(=O)CCNCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H25ClN2O/c1-3-17-8-4-6-15(2)20(17)23-19(24)11-13-22-12-10-16-7-5-9-18(21)14-16/h4-9,14,22H,3,10-13H2,1-2H3,(H,23,24) |
| InChIKey | ZGKFLYAROYCCAR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|