About N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1,3-benzothiazol-2-amine
N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1,3-benzothiazol-2-amine (PubChem CID 1090335) has the molecular formula C16H14N4S
and a molecular weight of 294.38 g/mol. Its IUPAC name is N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1,3-benzothiazol-2-amine |
| PubChem CID | 1090335 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1,3-benzothiazol-2-amine |
| SMILES | Cc1cccn2cc(CNc3nc4ccccc4s3)nc12 |
| InChI | InChI=1S/C16H14N4S/c1-11-5-4-8-20-10-12(18-15(11)20)9-17-16-19-13-6-2-3-7-14(13)21-16/h2-8,10H,9H2,1H3,(H,17,19) |
| InChIKey | XAUNJGJRPVRUIE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1,3-benzothiazol-2-amine?
The IUPAC name of N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1,3-benzothiazol-2-amine (CID 1090335) is N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1,3-benzothiazol-2-amine.
What is the SMILES notation for N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1,3-benzothiazol-2-amine?
The canonical SMILES for N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1,3-benzothiazol-2-amine is Cc1cccn2cc(CNc3nc4ccccc4s3)nc12.
What is the InChIKey of N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1,3-benzothiazol-2-amine?
The InChIKey is XAUNJGJRPVRUIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4S/c1-11-5-4-8-20-10-12(18-15(11)20)9-17-16-19-13-6-2-3-7-14(13)21-16/h2-8,10H,9H2,1H3,(H,17,19).
What are the key properties of N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1,3-benzothiazol-2-amine?
N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1,3-benzothiazol-2-amine has a molecular weight of 294.38 g/mol, XLogP of 3.86, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1,3-benzothiazol-2-amine is sourced from PubChem (CID 1090335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).