C18H17F3N2O — CID 109034854
3-(2,3-dihydroindol-1-yl)-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 109034854) has the molecular formula C18H17F3N2O and a molecular weight of 334.34 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-yl)-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(2,3-dihydroindol-1-yl)-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 109034854 |
| Molecular Formula | C18H17F3N2O |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3-(2,3-dihydroindol-1-yl)-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCN1CCc2ccccc21)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H17F3N2O/c19-18(20,21)14-6-2-3-7-15(14)22-17(24)10-12-23-11-9-13-5-1-4-8-16(13)23/h1-8H,9-12H2,(H,22,24) |
| InChIKey | HTNCGZWUTSTXSA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |