C21H27N3O — CID 109036061
3-(2,3-dimethylanilino)-N-(4-pyrrolidin-1-ylphenyl)propanamide (PubChem CID 109036061) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 3-(2,3-dimethylanilino)-N-(4-pyrrolidin-1-ylphenyl)propanamide.
| Compound Name | 3-(2,3-dimethylanilino)-N-(4-pyrrolidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 109036061 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 3-(2,3-dimethylanilino)-N-(4-pyrrolidin-1-ylphenyl)propanamide |
| SMILES | Cc1cccc(NCCC(=O)Nc2ccc(N3CCCC3)cc2)c1C |
| InChI | InChI=1S/C21H27N3O/c1-16-6-5-7-20(17(16)2)22-13-12-21(25)23-18-8-10-19(11-9-18)24-14-3-4-15-24/h5-11,22H,3-4,12-15H2,1-2H3,(H,23,25) |
| InChIKey | XVJBZLJELUNQDK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|